C14H17BrF2O2 — CID 116522401
5-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-2,2-dimethyloxolane (PubChem CID 116522401) has the molecular formula C14H17BrF2O2 and a molecular weight of 335.19 g/mol. Its IUPAC name is 5-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-2,2-dimethyloxolane.
| Compound Name | 5-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 116522401 |
| Molecular Formula | C14H17BrF2O2 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 5-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-2,2-dimethyloxolane |
| SMILES | CC1(C)CCC(COc2c(F)cc(CBr)cc2F)O1 |
| InChI | InChI=1S/C14H17BrF2O2/c1-14(2)4-3-10(19-14)8-18-13-11(16)5-9(7-15)6-12(13)17/h5-6,10H,3-4,7-8H2,1-2H3 |
| InChIKey | ITSPDJAUSUZKKC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|