C13H18BFO4 — CID 114674517
[3-[(5,5-dimethyloxolan-2-yl)methoxy]-4-fluorophenyl]boronic acid (PubChem CID 114674517) has the molecular formula C13H18BFO4 and a molecular weight of 268.09 g/mol. Its IUPAC name is [3-[(5,5-dimethyloxolan-2-yl)methoxy]-4-fluorophenyl]boronic acid.
| Compound Name | [3-[(5,5-dimethyloxolan-2-yl)methoxy]-4-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 114674517 |
| Molecular Formula | C13H18BFO4 |
| Molecular Weight | 268.09 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | [3-[(5,5-dimethyloxolan-2-yl)methoxy]-4-fluorophenyl]boronic acid |
| SMILES | CC1(C)CCC(COc2cc(B(O)O)ccc2F)O1 |
| InChI | InChI=1S/C13H18BFO4/c1-13(2)6-5-10(19-13)8-18-12-7-9(14(16)17)3-4-11(12)15/h3-4,7,10,16-17H,5-6,8H2,1-2H3 |
| InChIKey | BATIVSPGHPUFQV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.09 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|