C14H18FNO2S — CID 116521867
4-[(5,5-dimethyloxolan-2-yl)methoxy]-2-fluorobenzenecarbothioamide (PubChem CID 116521867) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-2-yl)methoxy]-2-fluorobenzenecarbothioamide.
| Compound Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 116521867 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]-2-fluorobenzenecarbothioamide |
| SMILES | CC1(C)CCC(COc2ccc(C(N)=S)c(F)c2)O1 |
| InChI | InChI=1S/C14H18FNO2S/c1-14(2)6-5-10(18-14)8-17-9-3-4-11(13(16)19)12(15)7-9/h3-4,7,10H,5-6,8H2,1-2H3,(H2,16,19) |
| InChIKey | WDGJJGQKGPPSDS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|