C16H21NO3 — CID 107684342
(NE)-N-[5-[(5,5-dimethyloxolan-2-yl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 107684342) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (NE)-N-[5-[(5,5-dimethyloxolan-2-yl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[5-[(5,5-dimethyloxolan-2-yl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 107684342 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (NE)-N-[5-[(5,5-dimethyloxolan-2-yl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | CC1(C)CCC(COc2ccc3c(c2)CC/C3=N\O)O1 |
| InChI | InChI=1S/C16H21NO3/c1-16(2)8-7-13(20-16)10-19-12-4-5-14-11(9-12)3-6-15(14)17-18/h4-5,9,13,18H,3,6-8,10H2,1-2H3/b17-15+ |
| InChIKey | HAQMBXGCLHXVNK-BMRADRMJSA-N |
| XLogP | 3.15 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|