C13H15NO2 — CID 107684224
(NZ)-N-[5-(cyclopropylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 107684224) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (NZ)-N-[5-(cyclopropylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[5-(cyclopropylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 107684224 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (NZ)-N-[5-(cyclopropylmethoxy)-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | O/N=C1/CCc2cc(OCC3CC3)ccc21 |
| InChI | InChI=1S/C13H15NO2/c15-14-13-6-3-10-7-11(4-5-12(10)13)16-8-9-1-2-9/h4-5,7,9,15H,1-3,6,8H2/b14-13- |
| InChIKey | CENLSBKBBUOZBR-YPKPFQOOSA-N |
| XLogP | 2.60 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|