C11H11NO3 — CID 6412519
(2E)-2-hydroxyimino-6-methoxy-3,4-dihydronaphthalen-1-one (PubChem CID 6412519) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-6-methoxy-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-hydroxyimino-6-methoxy-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 6412519 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2E)-2-hydroxyimino-6-methoxy-3,4-dihydronaphthalen-1-one |
| SMILES | COc1ccc2c(c1)CC/C(=N\O)C2=O |
| InChI | InChI=1S/C11H11NO3/c1-15-8-3-4-9-7(6-8)2-5-10(12-14)11(9)13/h3-4,6,14H,2,5H2,1H3/b12-10+ |
| InChIKey | UHLKGOLZLXVSOR-ZRDIBKRKSA-N |
| XLogP | 1.65 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|