About 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one
2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one (PubChem CID 130407306) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one |
| PubChem CID | 130407306 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one |
| SMILES | COc1ccc2c(c1)C(=O)C(=NO)C2.COc1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C10H9NO3.C10H10O2/c1-14-7-3-2-6-4-9(11-13)10(12)8(6)5-7;1-12-8-4-2-7-3-5-10(11)9(7)6-8/h2-3,5,13H,4H2,1H3;2,4,6H,3,5H2,1H3 |
| InChIKey | UQIHOQBGLBGGFS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one?
The IUPAC name of 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one (CID 130407306) is 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one?
The canonical SMILES for 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one is COc1ccc2c(c1)C(=O)C(=NO)C2.COc1ccc2c(c1)C(=O)CC2.
What is the InChIKey of 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one?
The InChIKey is UQIHOQBGLBGGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3.C10H10O2/c1-14-7-3-2-6-4-9(11-13)10(12)8(6)5-7;1-12-8-4-2-7-3-5-10(11)9(7)6-8/h2-3,5,13H,4H2,1H3;2,4,6H,3,5H2,1H3.
What are the key properties of 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one?
2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one has a molecular weight of 353.37 g/mol, XLogP of 3.09, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 130407306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).