C20H26O2 — CID 90841573
ethane;5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one (PubChem CID 90841573) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is ethane;5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one.
| Compound Name | ethane;5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 90841573 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | ethane;5-methoxytricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one |
| SMILES | CC.CC.COc1ccc2c(c1)C(=O)c1ccccc1CC2 |
| InChI | InChI=1S/C16H14O2.2C2H6/c1-18-13-9-8-12-7-6-11-4-2-3-5-14(11)16(17)15(12)10-13;2*1-2/h2-5,8-10H,6-7H2,1H3;2*1-2H3 |
| InChIKey | VHJTZZNWTFHFLX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |