C20H20O2 — CID 125266195
(3Z)-5-methoxy-3-(6-methoxy-2,3-dihydroinden-1-ylidene)-1,2-dihydroindene (PubChem CID 125266195) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3Z)-5-methoxy-3-(6-methoxy-2,3-dihydroinden-1-ylidene)-1,2-dihydroindene.
| Compound Name | (3Z)-5-methoxy-3-(6-methoxy-2,3-dihydroinden-1-ylidene)-1,2-dihydroindene |
|---|---|
| PubChem CID | 125266195 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (3Z)-5-methoxy-3-(6-methoxy-2,3-dihydroinden-1-ylidene)-1,2-dihydroindene |
| SMILES | COc1ccc2c(c1)/C(=C1/CCc3ccc(OC)cc31)CC2 |
| InChI | InChI=1S/C20H20O2/c1-21-15-7-3-13-5-9-17(19(13)11-15)18-10-6-14-4-8-16(22-2)12-20(14)18/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3/b18-17- |
| InChIKey | NMUDNBVQMPOJDG-ZCXUNETKSA-N |
| XLogP | 4.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|