C11H11IO2 — CID 11266614
2-iodo-7-methoxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 11266614) has the molecular formula C11H11IO2 and a molecular weight of 302.11 g/mol. Its IUPAC name is 2-iodo-7-methoxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-iodo-7-methoxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 11266614 |
| Molecular Formula | C11H11IO2 |
| Molecular Weight | 302.11 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2-iodo-7-methoxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | COc1ccc2c(c1)C(=O)C(I)CC2 |
| InChI | InChI=1S/C11H11IO2/c1-14-8-4-2-7-3-5-10(12)11(13)9(7)6-8/h2,4,6,10H,3,5H2,1H3 |
| InChIKey | RGHCYGNSIBOBLA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.11 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|