C14H15NO2 — CID 10799427
8-methoxy-3-methyl-4,5-dihydro-3aH-benzo[e]indol-2-one (PubChem CID 10799427) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 8-methoxy-3-methyl-4,5-dihydro-3aH-benzo[e]indol-2-one.
| Compound Name | 8-methoxy-3-methyl-4,5-dihydro-3aH-benzo[e]indol-2-one |
|---|---|
| PubChem CID | 10799427 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 8-methoxy-3-methyl-4,5-dihydro-3aH-benzo[e]indol-2-one |
| SMILES | COc1ccc2c(c1)C1=CC(=O)N(C)C1CC2 |
| InChI | InChI=1S/C14H15NO2/c1-15-13-6-4-9-3-5-10(17-2)7-11(9)12(13)8-14(15)16/h3,5,7-8,13H,4,6H2,1-2H3 |
| InChIKey | GDCBHOGABDEINV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |