C25H30N2O7 — CID 172932814
(2E)-2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one;3-methylbutyl nitrite (PubChem CID 172932814) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one;3-methylbutyl nitrite.
| Compound Name | (2E)-2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one;3-methylbutyl nitrite |
|---|---|
| PubChem CID | 172932814 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (2E)-2-hydroxyimino-6-methoxy-3H-inden-1-one;6-methoxy-2,3-dihydroinden-1-one;3-methylbutyl nitrite |
| SMILES | CC(C)CCON=O.COc1ccc2c(c1)C(=O)/C(=N/O)C2.COc1ccc2c(c1)C(=O)CC2 |
| InChI | InChI=1S/C10H9NO3.C10H10O2.C5H11NO2/c1-14-7-3-2-6-4-9(11-13)10(12)8(6)5-7;1-12-8-4-2-7-3-5-10(11)9(7)6-8;1-5(2)3-4-8-6-7/h2-3,5,13H,4H2,1H3;2,4,6H,3,5H2,1H3;5H,3-4H2,1-2H3/b11-9+;; |
| InChIKey | LKCRRZVIKYEPFT-OTBYXNOXSA-N |
| XLogP | 4.82 |
| TPSA | 123.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|