C20H21NO6 — CID 2876981
[(5-methoxy-2,3-dihydroinden-1-ylidene)amino] 3,4,5-trimethoxybenzoate (PubChem CID 2876981) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is [(5-methoxy-2,3-dihydroinden-1-ylidene)amino] 3,4,5-trimethoxybenzoate.
| Compound Name | [(5-methoxy-2,3-dihydroinden-1-ylidene)amino] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 2876981 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [(5-methoxy-2,3-dihydroinden-1-ylidene)amino] 3,4,5-trimethoxybenzoate |
| SMILES | COc1ccc2c(c1)CCC2=NOC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H21NO6/c1-23-14-6-7-15-12(9-14)5-8-16(15)21-27-20(22)13-10-17(24-2)19(26-4)18(11-13)25-3/h6-7,9-11H,5,8H2,1-4H3 |
| InChIKey | PNNANHJATNSSLZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|