C23H20N2O7 — CID 5120394
[(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] 3,4,5-trimethoxybenzoate (PubChem CID 5120394) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is [(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] 3,4,5-trimethoxybenzoate.
| Compound Name | [(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 5120394 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [(4-benzoyloxyiminocyclohexa-2,5-dien-1-ylidene)amino] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)ON=C2C=CC(=NOC(=O)c3ccccc3)C=C2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O7/c1-28-19-13-16(14-20(29-2)21(19)30-3)23(27)32-25-18-11-9-17(10-12-18)24-31-22(26)15-7-5-4-6-8-15/h4-14H,1-3H3/b24-17-,25-18+ |
| InChIKey | NOJMVDHCMSDABF-KGOJTIBSSA-N |
| XLogP | 3.56 |
| TPSA | 105.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|