C19H19NO5S — CID 6522386
[(Z)-2,3-dihydrothiochromen-4-ylideneamino] 3,4,5-trimethoxybenzoate (PubChem CID 6522386) has the molecular formula C19H19NO5S and a molecular weight of 373.43 g/mol. Its IUPAC name is [(Z)-2,3-dihydrothiochromen-4-ylideneamino] 3,4,5-trimethoxybenzoate.
| Compound Name | [(Z)-2,3-dihydrothiochromen-4-ylideneamino] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 6522386 |
| Molecular Formula | C19H19NO5S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [(Z)-2,3-dihydrothiochromen-4-ylideneamino] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)O/N=C2/CCSc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO5S/c1-22-15-10-12(11-16(23-2)18(15)24-3)19(21)25-20-14-8-9-26-17-7-5-4-6-13(14)17/h4-7,10-11H,8-9H2,1-3H3/b20-14- |
| InChIKey | NALAOYXZTYMOSO-ZHZULCJRSA-N |
| XLogP | 3.77 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|