C19H18N2O6 — CID 1366716
[(6-methoxy-5-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-methoxybenzoate (PubChem CID 1366716) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is [(6-methoxy-5-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-methoxybenzoate.
| Compound Name | [(6-methoxy-5-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-methoxybenzoate |
|---|---|
| PubChem CID | 1366716 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [(6-methoxy-5-nitro-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)ON=C1CCCc2c1ccc(OC)c2[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N2O6/c1-25-16-9-4-3-6-14(16)19(22)27-20-15-8-5-7-13-12(15)10-11-17(26-2)18(13)21(23)24/h3-4,6,9-11H,5,7-8H2,1-2H3 |
| InChIKey | FEZNMZZCAVNZQH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|