C23H21NO3 — CID 6523248
[(Z)-(6-methoxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] naphthalene-1-carboxylate (PubChem CID 6523248) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is [(Z)-(6-methoxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] naphthalene-1-carboxylate.
| Compound Name | [(Z)-(6-methoxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 6523248 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [(Z)-(6-methoxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] naphthalene-1-carboxylate |
| SMILES | COc1ccc2c(c1C)CCC/C2=N/OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H21NO3/c1-15-17-10-6-12-21(19(17)13-14-22(15)26-2)24-27-23(25)20-11-5-8-16-7-3-4-9-18(16)20/h3-5,7-9,11,13-14H,6,10,12H2,1-2H3/b24-21- |
| InChIKey | MGQYFTGIQUKURW-FLFQWRMESA-N |
| XLogP | 5.05 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|