About [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate
[(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate (PubChem CID 58276074) has the molecular formula C20H15NO3
and a molecular weight of 317.34 g/mol. Its IUPAC name is [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate.
Molecular Properties
| Compound Name | [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate |
| PubChem CID | 58276074 |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O/N=C1\COc2ccc3ccccc3c21 |
| InChI | InChI=1S/C20H15NO3/c1-13-6-2-4-8-15(13)20(22)24-21-17-12-23-18-11-10-14-7-3-5-9-16(14)19(17)18/h2-11H,12H2,1H3/b21-17+ |
| InChIKey | WYDREURKXJBYPW-HEHNFIMWSA-N |
| XLogP | 4.10 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate?
The IUPAC name of [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate (CID 58276074) is [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate.
What is the SMILES notation for [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate?
The canonical SMILES for [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate is Cc1ccccc1C(=O)O/N=C1\COc2ccc3ccccc3c21.
What is the InChIKey of [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate?
The InChIKey is WYDREURKXJBYPW-HEHNFIMWSA-N. The full InChI is InChI=1S/C20H15NO3/c1-13-6-2-4-8-15(13)20(22)24-21-17-12-23-18-11-10-14-7-3-5-9-16(14)19(17)18/h2-11H,12H2,1H3/b21-17+.
What are the key properties of [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate?
[(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate has a molecular weight of 317.34 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-benzo[e][1]benzofuran-1-ylideneamino] 2-methylbenzoate is sourced from PubChem (CID 58276074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).