C13H8F3NO4S — CID 172959972
[(E)-benzo[e][1]benzofuran-1-ylideneamino] trifluoromethanesulfonate (PubChem CID 172959972) has the molecular formula C13H8F3NO4S and a molecular weight of 331.27 g/mol. Its IUPAC name is [(E)-benzo[e][1]benzofuran-1-ylideneamino] trifluoromethanesulfonate.
| Compound Name | [(E)-benzo[e][1]benzofuran-1-ylideneamino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172959972 |
| Molecular Formula | C13H8F3NO4S |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | [(E)-benzo[e][1]benzofuran-1-ylideneamino] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O/N=C1/COc2ccc3ccccc3c21)C(F)(F)F |
| InChI | InChI=1S/C13H8F3NO4S/c14-13(15,16)22(18,19)21-17-10-7-20-11-6-5-8-3-1-2-4-9(8)12(10)11/h1-6H,7H2/b17-10- |
| InChIKey | PALBHKNWJAVDFY-YVLHZVERSA-N |
| XLogP | 2.80 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|