C21H17NO3 — CID 72712552
[(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-naphthalen-1-ylmethanone (PubChem CID 72712552) has the molecular formula C21H17NO3 and a molecular weight of 331.37 g/mol. Its IUPAC name is [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-naphthalen-1-ylmethanone.
| Compound Name | [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 72712552 |
| Molecular Formula | C21H17NO3 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-naphthalen-1-ylmethanone |
| SMILES | CO/N=C1\CCOc2cccc(C(=O)c3cccc4ccccc34)c21 |
| InChI | InChI=1S/C21H17NO3/c1-24-22-18-12-13-25-19-11-5-10-17(20(18)19)21(23)16-9-4-7-14-6-2-3-8-15(14)16/h2-11H,12-13H2,1H3/b22-18+ |
| InChIKey | NWNCXKQWBPHGJJ-RELWKKBWSA-N |
| XLogP | 4.20 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|