About [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone
[(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone (PubChem CID 72712550) has the molecular formula C18H17NO4
and a molecular weight of 311.34 g/mol. Its IUPAC name is [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone |
| PubChem CID | 72712550 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone |
| SMILES | CO/N=C1\CCOc2cccc(C(=O)c3ccccc3OC)c21 |
| InChI | InChI=1S/C18H17NO4/c1-21-15-8-4-3-6-12(15)18(20)13-7-5-9-16-17(13)14(19-22-2)10-11-23-16/h3-9H,10-11H2,1-2H3/b19-14+ |
| InChIKey | MUOXVZBPJJMZTR-XMHGGMMESA-N |
| XLogP | 3.06 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone?
The IUPAC name of [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone (CID 72712550) is [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone.
What is the SMILES notation for [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone?
The canonical SMILES for [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone is CO/N=C1\CCOc2cccc(C(=O)c3ccccc3OC)c21.
What is the InChIKey of [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone?
The InChIKey is MUOXVZBPJJMZTR-XMHGGMMESA-N. The full InChI is InChI=1S/C18H17NO4/c1-21-15-8-4-3-6-12(15)18(20)13-7-5-9-16-17(13)14(19-22-2)10-11-23-16/h3-9H,10-11H2,1-2H3/b19-14+.
What are the key properties of [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone?
[(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone has a molecular weight of 311.34 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E)-4-methoxyimino-2,3-dihydrochromen-5-yl]-(2-methoxyphenyl)methanone is sourced from PubChem (CID 72712550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).