C17H7F5O — CID 146007709
naphthalen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 146007709) has the molecular formula C17H7F5O and a molecular weight of 322.23 g/mol. Its IUPAC name is naphthalen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | naphthalen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 146007709 |
| Molecular Formula | C17H7F5O |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | naphthalen-1-yl-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H7F5O/c18-12-11(13(19)15(21)16(22)14(12)20)17(23)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | XBYYWUHNXHWSDU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|