C23H14O3 — CID 67892351
1,3-dinaphthalen-1-ylpropane-1,2,3-trione (PubChem CID 67892351) has the molecular formula C23H14O3 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1,3-dinaphthalen-1-ylpropane-1,2,3-trione.
| Compound Name | 1,3-dinaphthalen-1-ylpropane-1,2,3-trione |
|---|---|
| PubChem CID | 67892351 |
| Molecular Formula | C23H14O3 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1,3-dinaphthalen-1-ylpropane-1,2,3-trione |
| SMILES | O=C(C(=O)c1cccc2ccccc12)C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H14O3/c24-21(19-13-5-9-15-7-1-3-11-17(15)19)23(26)22(25)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
| InChIKey | DKUHKQQUVCGGDC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|