C28H24O3 — CID 140639946
1,8-dinaphthalen-1-yloctane-1,2,8-trione (PubChem CID 140639946) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1,8-dinaphthalen-1-yloctane-1,2,8-trione.
| Compound Name | 1,8-dinaphthalen-1-yloctane-1,2,8-trione |
|---|---|
| PubChem CID | 140639946 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1,8-dinaphthalen-1-yloctane-1,2,8-trione |
| SMILES | O=C(CCCCCC(=O)c1cccc2ccccc12)C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H24O3/c29-26(24-16-8-12-20-10-4-6-14-22(20)24)18-2-1-3-19-27(30)28(31)25-17-9-13-21-11-5-7-15-23(21)25/h4-17H,1-3,18-19H2 |
| InChIKey | BBPNEZXFNGFRMI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|