C28H24O3 — CID 140639848
1,8-dinaphthalen-1-yloctane-1,5,7-trione (PubChem CID 140639848) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1,8-dinaphthalen-1-yloctane-1,5,7-trione.
| Compound Name | 1,8-dinaphthalen-1-yloctane-1,5,7-trione |
|---|---|
| PubChem CID | 140639848 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 1,8-dinaphthalen-1-yloctane-1,5,7-trione |
| SMILES | O=C(CCCC(=O)c1cccc2ccccc12)CC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H24O3/c29-23(19-24(30)18-22-12-5-10-20-8-1-3-14-25(20)22)13-7-17-28(31)27-16-6-11-21-9-2-4-15-26(21)27/h1-6,8-12,14-16H,7,13,17-19H2 |
| InChIKey | RCIVGWPJNUNNNT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|