About sodium;hydride;methyl naphthalene-1-carboxylate
sodium;hydride;methyl naphthalene-1-carboxylate (PubChem CID 173423630) has the molecular formula C12H11NaO2
and a molecular weight of 210.21 g/mol. Its IUPAC name is sodium;hydride;methyl naphthalene-1-carboxylate.
Molecular Properties
| Compound Name | sodium;hydride;methyl naphthalene-1-carboxylate |
| PubChem CID | 173423630 |
| Molecular Formula | C12H11NaO2 |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | sodium;hydride;methyl naphthalene-1-carboxylate |
| SMILES | COC(=O)c1cccc2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C12H10O2.Na.H/c1-14-12(13)11-8-4-6-9-5-2-3-7-10(9)11;;/h2-8H,1H3;;/q;+1;-1 |
| InChIKey | MFPZWAALXBKVLE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;methyl naphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;methyl naphthalene-1-carboxylate?
The IUPAC name of sodium;hydride;methyl naphthalene-1-carboxylate (CID 173423630) is sodium;hydride;methyl naphthalene-1-carboxylate.
What is the SMILES notation for sodium;hydride;methyl naphthalene-1-carboxylate?
The canonical SMILES for sodium;hydride;methyl naphthalene-1-carboxylate is COC(=O)c1cccc2ccccc12.[H-].[Na+].
What is the InChIKey of sodium;hydride;methyl naphthalene-1-carboxylate?
The InChIKey is MFPZWAALXBKVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.Na.H/c1-14-12(13)11-8-4-6-9-5-2-3-7-10(9)11;;/h2-8H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;methyl naphthalene-1-carboxylate?
sodium;hydride;methyl naphthalene-1-carboxylate has a molecular weight of 210.21 g/mol, XLogP of -0.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;methyl naphthalene-1-carboxylate is sourced from PubChem (CID 173423630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).