C14H12O4 — CID 11459190
dimethyl naphthalene-1,6-dicarboxylate (PubChem CID 11459190) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is dimethyl naphthalene-1,6-dicarboxylate.
| Compound Name | dimethyl naphthalene-1,6-dicarboxylate |
|---|---|
| PubChem CID | 11459190 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | dimethyl naphthalene-1,6-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(C(=O)OC)cccc2c1 |
| InChI | InChI=1S/C14H12O4/c1-17-13(15)10-6-7-11-9(8-10)4-3-5-12(11)14(16)18-2/h3-8H,1-2H3 |
| InChIKey | JZZYEPMPRIJICF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |