C28H26O12 — CID 67578503
dimethyl benzene-1,2-dicarboxylate;dimethyl benzene-1,3-dicarboxylate;terephthalic acid (PubChem CID 67578503) has the molecular formula C28H26O12 and a molecular weight of 554.50 g/mol. Its IUPAC name is dimethyl benzene-1,2-dicarboxylate;dimethyl benzene-1,3-dicarboxylate;terephthalic acid.
| Compound Name | dimethyl benzene-1,2-dicarboxylate;dimethyl benzene-1,3-dicarboxylate;terephthalic acid |
|---|---|
| PubChem CID | 67578503 |
| Molecular Formula | C28H26O12 |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | dimethyl benzene-1,2-dicarboxylate;dimethyl benzene-1,3-dicarboxylate;terephthalic acid |
| SMILES | COC(=O)c1cccc(C(=O)OC)c1.COC(=O)c1ccccc1C(=O)OC.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/2C10H10O4.C8H6O4/c1-13-9(11)7-4-3-5-8(6-7)10(12)14-2;1-13-9(11)7-5-3-4-6-8(7)10(12)14-2;9-7(10)5-1-2-6(4-3-5)8(11)12/h2*3-6H,1-2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | CRVCZRQNQPGGQP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|