About methyl 3-acetylbenzoate
methyl 3-acetylbenzoate (PubChem CID 15094405) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is methyl 3-acetylbenzoate.
Molecular Properties
| Compound Name | methyl 3-acetylbenzoate |
| PubChem CID | 15094405 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | methyl 3-acetylbenzoate |
| SMILES | COC(=O)c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C10H10O3/c1-7(11)8-4-3-5-9(6-8)10(12)13-2/h3-6H,1-2H3 |
| InChIKey | NCNUIUIDKJSGDM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-acetylbenzoate?
The IUPAC name of methyl 3-acetylbenzoate (CID 15094405) is methyl 3-acetylbenzoate.
What is the SMILES notation for methyl 3-acetylbenzoate?
The canonical SMILES for methyl 3-acetylbenzoate is COC(=O)c1cccc(C(C)=O)c1.
What is the InChIKey of methyl 3-acetylbenzoate?
The InChIKey is NCNUIUIDKJSGDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-7(11)8-4-3-5-9(6-8)10(12)13-2/h3-6H,1-2H3.
What are the key properties of methyl 3-acetylbenzoate?
methyl 3-acetylbenzoate has a molecular weight of 178.19 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-acetylbenzoate is sourced from PubChem (CID 15094405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).