About methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol
methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol (PubChem CID 176957637) has the molecular formula C19H23NO2S
and a molecular weight of 329.47 g/mol. Its IUPAC name is methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol.
Molecular Properties
| Compound Name | methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol |
| PubChem CID | 176957637 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol |
| SMILES | CC/C=C(\C)S.[H]/N=C(\C)c1cccc2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C14H13NO2.C5H10S/c1-9(15)12-5-3-4-10-8-11(14(16)17-2)6-7-13(10)12;1-3-4-5(2)6/h3-8,15H,1-2H3;4,6H,3H2,1-2H3/b15-9+;5-4+ |
| InChIKey | CJRUKMOTHLMVGH-ZMGMGYHYSA-N |
| XLogP | 5.24 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol?
The IUPAC name of methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol (CID 176957637) is methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol.
What is the SMILES notation for methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol?
The canonical SMILES for methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol is CC/C=C(\C)S.[H]/N=C(\C)c1cccc2cc(C(=O)OC)ccc12.
What is the InChIKey of methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol?
The InChIKey is CJRUKMOTHLMVGH-ZMGMGYHYSA-N. The full InChI is InChI=1S/C14H13NO2.C5H10S/c1-9(15)12-5-3-4-10-8-11(14(16)17-2)6-7-13(10)12;1-3-4-5(2)6/h3-8,15H,1-2H3;4,6H,3H2,1-2H3/b15-9+;5-4+.
What are the key properties of methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol?
methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol has a molecular weight of 329.47 g/mol, XLogP of 5.24, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethanimidoylnaphthalene-2-carboxylate;(E)-pent-2-ene-2-thiol is sourced from PubChem (CID 176957637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).