About (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate
(E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate (PubChem CID 176957825) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate |
| PubChem CID | 176957825 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate |
| SMILES | CC/C=C(\N)S.[H]/N=C(\C)c1cccc2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C14H13NO2.C4H9NS/c1-9(15)12-5-3-4-10-8-11(14(16)17-2)6-7-13(10)12;1-2-3-4(5)6/h3-8,15H,1-2H3;3,6H,2,5H2,1H3/b15-9+;4-3+ |
| InChIKey | ZXFNBVSKSXONND-DYEWSOARSA-N |
| XLogP | 4.14 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate?
The IUPAC name of (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate (CID 176957825) is (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate.
What is the SMILES notation for (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate?
The canonical SMILES for (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate is CC/C=C(\N)S.[H]/N=C(\C)c1cccc2cc(C(=O)OC)ccc12.
What is the InChIKey of (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate?
The InChIKey is ZXFNBVSKSXONND-DYEWSOARSA-N. The full InChI is InChI=1S/C14H13NO2.C4H9NS/c1-9(15)12-5-3-4-10-8-11(14(16)17-2)6-7-13(10)12;1-2-3-4(5)6/h3-8,15H,1-2H3;3,6H,2,5H2,1H3/b15-9+;4-3+.
What are the key properties of (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate?
(E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate has a molecular weight of 330.45 g/mol, XLogP of 4.14, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-aminobut-1-ene-1-thiol;methyl 5-ethanimidoylnaphthalene-2-carboxylate is sourced from PubChem (CID 176957825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).