C12H7ClF2O — CID 91636167
2-chloro-2,2-difluoro-1-naphthalen-1-ylethanone (PubChem CID 91636167) has the molecular formula C12H7ClF2O and a molecular weight of 240.64 g/mol. Its IUPAC name is 2-chloro-2,2-difluoro-1-naphthalen-1-ylethanone.
| Compound Name | 2-chloro-2,2-difluoro-1-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 91636167 |
| Molecular Formula | C12H7ClF2O |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-chloro-2,2-difluoro-1-naphthalen-1-ylethanone |
| SMILES | O=C(c1cccc2ccccc12)C(F)(F)Cl |
| InChI | InChI=1S/C12H7ClF2O/c13-12(14,15)11(16)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | AXAMACIQJRTVJN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|