C14H9F3O — CID 101484406
(E)-4,4,4-trifluoro-1-naphthalen-1-ylbut-2-en-1-one (PubChem CID 101484406) has the molecular formula C14H9F3O and a molecular weight of 250.22 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-1-naphthalen-1-ylbut-2-en-1-one.
| Compound Name | (E)-4,4,4-trifluoro-1-naphthalen-1-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 101484406 |
| Molecular Formula | C14H9F3O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (E)-4,4,4-trifluoro-1-naphthalen-1-ylbut-2-en-1-one |
| SMILES | O=C(/C=C/C(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H9F3O/c15-14(16,17)9-8-13(18)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H/b9-8+ |
| InChIKey | IQVCDQKBFKSDJS-CMDGGOBGSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|