C14H9F3O2 — CID 67502188
(E)-1,1,1-trifluoro-4-hydroxy-4-naphthalen-1-ylbut-3-en-2-one (PubChem CID 67502188) has the molecular formula C14H9F3O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-hydroxy-4-naphthalen-1-ylbut-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-4-hydroxy-4-naphthalen-1-ylbut-3-en-2-one |
|---|---|
| PubChem CID | 67502188 |
| Molecular Formula | C14H9F3O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-hydroxy-4-naphthalen-1-ylbut-3-en-2-one |
| SMILES | O=C(/C=C(/O)c1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C14H9F3O2/c15-14(16,17)13(19)8-12(18)11-7-3-5-9-4-1-2-6-10(9)11/h1-8,18H/b12-8+ |
| InChIKey | ZRAYSSKWYTWFQJ-XYOKQWHBSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|