C12H7F3S — CID 23496318
2,2,2-trifluoro-1-naphthalen-1-ylethanethione (PubChem CID 23496318) has the molecular formula C12H7F3S and a molecular weight of 240.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-naphthalen-1-ylethanethione.
| Compound Name | 2,2,2-trifluoro-1-naphthalen-1-ylethanethione |
|---|---|
| PubChem CID | 23496318 |
| Molecular Formula | C12H7F3S |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2,2,2-trifluoro-1-naphthalen-1-ylethanethione |
| SMILES | FC(F)(F)C(=S)c1cccc2ccccc12 |
| InChI | InChI=1S/C12H7F3S/c13-12(14,15)11(16)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | LULURALBVBUNQZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|