C12H7Br2FO — CID 175439147
2,2-dibromo-2-fluoro-1-naphthalen-1-ylethanone (PubChem CID 175439147) has the molecular formula C12H7Br2FO and a molecular weight of 345.99 g/mol. Its IUPAC name is 2,2-dibromo-2-fluoro-1-naphthalen-1-ylethanone.
| Compound Name | 2,2-dibromo-2-fluoro-1-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 175439147 |
| Molecular Formula | C12H7Br2FO |
| Molecular Weight | 345.99 g/mol |
| Exact Mass | 343.88 |
| IUPAC Name | 2,2-dibromo-2-fluoro-1-naphthalen-1-ylethanone |
| SMILES | O=C(c1cccc2ccccc12)C(F)(Br)Br |
| InChI | InChI=1S/C12H7Br2FO/c13-12(14,15)11(16)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H |
| InChIKey | OZDOHCHUKTVCBM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.99 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|