C20H14O8 — CID 70544806
benzene-1,3,5-tricarboxylic acid;naphthalene-1-carboxylic acid (PubChem CID 70544806) has the molecular formula C20H14O8 and a molecular weight of 382.32 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;naphthalene-1-carboxylic acid.
| Compound Name | benzene-1,3,5-tricarboxylic acid;naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 70544806 |
| Molecular Formula | C20H14O8 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1.O=C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C11H8O2.C9H6O6/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-7H,(H,12,13);1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | GZAAAJPAVXQRGO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |