C21H18O5 — CID 174493325
2-methylbenzene-1,3-dicarboxylic acid;1-naphthalen-1-ylethanone (PubChem CID 174493325) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-methylbenzene-1,3-dicarboxylic acid;1-naphthalen-1-ylethanone.
| Compound Name | 2-methylbenzene-1,3-dicarboxylic acid;1-naphthalen-1-ylethanone |
|---|---|
| PubChem CID | 174493325 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-methylbenzene-1,3-dicarboxylic acid;1-naphthalen-1-ylethanone |
| SMILES | CC(=O)c1cccc2ccccc12.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C12H10O.C9H8O4/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-8H,1H3;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | KVGPVOOHJSROCD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |