C17H20O8 — CID 174662181
2-methylbenzene-1,3-dicarboxylic acid;bis(2-methylprop-2-enoic acid) (PubChem CID 174662181) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-methylbenzene-1,3-dicarboxylic acid;bis(2-methylprop-2-enoic acid).
| Compound Name | 2-methylbenzene-1,3-dicarboxylic acid;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 174662181 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-methylbenzene-1,3-dicarboxylic acid;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.2C4H6O2/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;2*1-3(2)4(5)6/h2-4H,1H3,(H,10,11)(H,12,13);2*1H2,2H3,(H,5,6) |
| InChIKey | YTGFTLYLOOMPLM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|