C24H38O12 — CID 161076356
bis(butane-1,4-diol);bis(2-methylprop-2-enoic acid);phthalic acid (PubChem CID 161076356) has the molecular formula C24H38O12 and a molecular weight of 518.56 g/mol. Its IUPAC name is bis(butane-1,4-diol);bis(2-methylprop-2-enoic acid);phthalic acid.
| Compound Name | bis(butane-1,4-diol);bis(2-methylprop-2-enoic acid);phthalic acid |
|---|---|
| PubChem CID | 161076356 |
| Molecular Formula | C24H38O12 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | bis(butane-1,4-diol);bis(2-methylprop-2-enoic acid);phthalic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.O=C(O)c1ccccc1C(=O)O.OCCCCO.OCCCCO |
| InChI | InChI=1S/C8H6O4.2C4H6O2.2C4H10O2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-3(2)4(5)6;2*5-3-1-2-4-6/h1-4H,(H,9,10)(H,11,12);2*1H2,2H3,(H,5,6);2*5-6H,1-4H2 |
| InChIKey | UFIDZOWWULYCPB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 230.12 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|