C15H20O8 — CID 174724266
ethane-1,2-diol;2-methylbenzene-1,3-dicarboxylic acid;2-methylprop-2-enoic acid (PubChem CID 174724266) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is ethane-1,2-diol;2-methylbenzene-1,3-dicarboxylic acid;2-methylprop-2-enoic acid.
| Compound Name | ethane-1,2-diol;2-methylbenzene-1,3-dicarboxylic acid;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174724266 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | ethane-1,2-diol;2-methylbenzene-1,3-dicarboxylic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.Cc1c(C(=O)O)cccc1C(=O)O.OCCO |
| InChI | InChI=1S/C9H8O4.C4H6O2.C2H6O2/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-3(2)4(5)6;3-1-2-4/h2-4H,1H3,(H,10,11)(H,12,13);1H2,2H3,(H,5,6);3-4H,1-2H2 |
| InChIKey | KKYAYTCREKATLB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|