C12H15ClO4 — CID 174884619
1-chloropropane;2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174884619) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 1-chloropropane;2-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 1-chloropropane;2-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174884619 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-chloropropane;2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | CCCCl.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C3H7Cl/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-2-3-4/h2-4H,1H3,(H,10,11)(H,12,13);2-3H2,1H3 |
| InChIKey | ZUUKZBRZXSLSPW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|