C13H14O4 — CID 174778770
bicyclo[1.1.0]butane;2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174778770) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is bicyclo[1.1.0]butane;2-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | bicyclo[1.1.0]butane;2-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174778770 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | bicyclo[1.1.0]butane;2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | C1C2CC12.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C4H6/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-3-2-4(1)3/h2-4H,1H3,(H,10,11)(H,12,13);3-4H,1-2H2 |
| InChIKey | GVJBLXKHPYWHQQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |