C15H20O5 — CID 174894159
methoxycyclopentane;2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174894159) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methoxycyclopentane;2-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | methoxycyclopentane;2-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174894159 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methoxycyclopentane;2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | COC1CCCC1.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C6H12O/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-7-6-4-2-3-5-6/h2-4H,1H3,(H,10,11)(H,12,13);6H,2-5H2,1H3 |
| InChIKey | GHPCYKSPCXGGGL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |