C17H23NO5 — CID 174555520
isocyanic acid;2-methylbenzene-1,3-dicarboxylic acid;methylcyclohexane (PubChem CID 174555520) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is isocyanic acid;2-methylbenzene-1,3-dicarboxylic acid;methylcyclohexane.
| Compound Name | isocyanic acid;2-methylbenzene-1,3-dicarboxylic acid;methylcyclohexane |
|---|---|
| PubChem CID | 174555520 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | isocyanic acid;2-methylbenzene-1,3-dicarboxylic acid;methylcyclohexane |
| SMILES | CC1CCCCC1.Cc1c(C(=O)O)cccc1C(=O)O.N=C=O |
| InChI | InChI=1S/C9H8O4.C7H14.CHNO/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-7-5-3-2-4-6-7;2-1-3/h2-4H,1H3,(H,10,11)(H,12,13);7H,2-6H2,1H3;2H |
| InChIKey | LULPABDJTKVXIE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|