C13H16O3 — CID 141251925
2-cyclohexyl-3-hydroxybenzoic acid (PubChem CID 141251925) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-cyclohexyl-3-hydroxybenzoic acid.
| Compound Name | 2-cyclohexyl-3-hydroxybenzoic acid |
|---|---|
| PubChem CID | 141251925 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-cyclohexyl-3-hydroxybenzoic acid |
| SMILES | O=C(O)c1cccc(O)c1C1CCCCC1 |
| InChI | InChI=1S/C13H16O3/c14-11-8-4-7-10(13(15)16)12(11)9-5-2-1-3-6-9/h4,7-9,14H,1-3,5-6H2,(H,15,16) |
| InChIKey | PFWCDOMFPGORMF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |