C22H24O4 — CID 174513742
(2-cyclohexyl-3-hydroxyphenyl)-phenylmethanone;prop-2-enoic acid (PubChem CID 174513742) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2-cyclohexyl-3-hydroxyphenyl)-phenylmethanone;prop-2-enoic acid.
| Compound Name | (2-cyclohexyl-3-hydroxyphenyl)-phenylmethanone;prop-2-enoic acid |
|---|---|
| PubChem CID | 174513742 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2-cyclohexyl-3-hydroxyphenyl)-phenylmethanone;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C(c1ccccc1)c1cccc(O)c1C1CCCCC1 |
| InChI | InChI=1S/C19H20O2.C3H4O2/c20-17-13-7-12-16(18(17)14-8-3-1-4-9-14)19(21)15-10-5-2-6-11-15;1-2-3(4)5/h2,5-7,10-14,20H,1,3-4,8-9H2;2H,1H2,(H,4,5) |
| InChIKey | JNSRBKUZRWWSJL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|