C39H48O6 — CID 175788014
bis(2-cyclohexyl-3-hydroxyphenyl)methanone;2-cyclohexyl-2-hydroxy-2-phenylacetic acid (PubChem CID 175788014) has the molecular formula C39H48O6 and a molecular weight of 612.81 g/mol. Its IUPAC name is bis(2-cyclohexyl-3-hydroxyphenyl)methanone;2-cyclohexyl-2-hydroxy-2-phenylacetic acid.
| Compound Name | bis(2-cyclohexyl-3-hydroxyphenyl)methanone;2-cyclohexyl-2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 175788014 |
| Molecular Formula | C39H48O6 |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | bis(2-cyclohexyl-3-hydroxyphenyl)methanone;2-cyclohexyl-2-hydroxy-2-phenylacetic acid |
| SMILES | O=C(O)C(O)(c1ccccc1)C1CCCCC1.O=C(c1cccc(O)c1C1CCCCC1)c1cccc(O)c1C1CCCCC1 |
| InChI | InChI=1S/C25H30O3.C14H18O3/c26-21-15-7-13-19(23(21)17-9-3-1-4-10-17)25(28)20-14-8-16-22(27)24(20)18-11-5-2-6-12-18;15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h7-8,13-18,26-27H,1-6,9-12H2;1,3-4,7-8,12,17H,2,5-6,9-10H2,(H,15,16) |
| InChIKey | GVUHFAKDCNSXPG-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |