C16H22O4 — CID 70868092
2-hydroxyethyl 2-cyclohexyl-2-hydroxy-2-phenylacetate (PubChem CID 70868092) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-hydroxyethyl 2-cyclohexyl-2-hydroxy-2-phenylacetate.
| Compound Name | 2-hydroxyethyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 70868092 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-hydroxyethyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
| SMILES | O=C(OCCO)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C16H22O4/c17-11-12-20-15(18)16(19,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1,3-4,7-8,14,17,19H,2,5-6,9-12H2 |
| InChIKey | ZCWWGSVEJFZYNX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |