C24H37NO4 — CID 22348527
4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;ethanol (PubChem CID 22348527) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;ethanol.
| Compound Name | 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;ethanol |
|---|---|
| PubChem CID | 22348527 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 4-(diethylamino)but-2-ynyl 2-cyclohexyl-2-hydroxy-2-phenylacetate;ethanol |
| SMILES | CCN(CC)CC#CCOC(=O)C(O)(c1ccccc1)C1CCCCC1.CCO |
| InChI | InChI=1S/C22H31NO3.C2H6O/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20;1-2-3/h5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3;3H,2H2,1H3 |
| InChIKey | GNJQBGIAIYUTGH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|